C12H11F3O4 — CID 123643594
benzyl 4,4,4-trifluoro-3-formyl-3-hydroxybutanoate (PubChem CID 123643594) has the molecular formula C12H11F3O4 and a molecular weight of 276.21 g/mol. Its IUPAC name is benzyl 4,4,4-trifluoro-3-formyl-3-hydroxybutanoate.
| Compound Name | benzyl 4,4,4-trifluoro-3-formyl-3-hydroxybutanoate |
|---|---|
| PubChem CID | 123643594 |
| Molecular Formula | C12H11F3O4 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | benzyl 4,4,4-trifluoro-3-formyl-3-hydroxybutanoate |
| SMILES | O=CC(O)(CC(=O)OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H11F3O4/c13-12(14,15)11(18,8-16)6-10(17)19-7-9-4-2-1-3-5-9/h1-5,8,18H,6-7H2 |
| InChIKey | PAMYGINZWIGJHR-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|