C22H28N4O — CID 123643640
1,3-dimethyl-N-[5-(2-methylpropyl)-4-azatetracyclo[7.4.0.02,5.03,8]trideca-1(9),10,12-trien-10-yl]pyrazole-4-carboxamide (PubChem CID 123643640) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is 1,3-dimethyl-N-[5-(2-methylpropyl)-4-azatetracyclo[7.4.0.02,5.03,8]trideca-1(9),10,12-trien-10-yl]pyrazole-4-carboxamide.
| Compound Name | 1,3-dimethyl-N-[5-(2-methylpropyl)-4-azatetracyclo[7.4.0.02,5.03,8]trideca-1(9),10,12-trien-10-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 123643640 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 1,3-dimethyl-N-[5-(2-methylpropyl)-4-azatetracyclo[7.4.0.02,5.03,8]trideca-1(9),10,12-trien-10-yl]pyrazole-4-carboxamide |
| SMILES | Cc1nn(C)cc1C(=O)Nc1cccc2c1C1CCC3(CC(C)C)NC1C23 |
| InChI | InChI=1S/C22H28N4O/c1-12(2)10-22-9-8-15-18-14(19(22)20(15)24-22)6-5-7-17(18)23-21(27)16-11-26(4)25-13(16)3/h5-7,11-12,15,19-20,24H,8-10H2,1-4H3,(H,23,27) |
| InChIKey | JAJBPQFZZLMSRE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |