About [(Z)-ethylideneamino] (E)-2-cyano-3-phenylprop-2-enoate
[(Z)-ethylideneamino] (E)-2-cyano-3-phenylprop-2-enoate (PubChem CID 123644224) has the molecular formula C12H10N2O2
and a molecular weight of 214.22 g/mol. Its IUPAC name is [(Z)-ethylideneamino] (E)-2-cyano-3-phenylprop-2-enoate.
Molecular Properties
| Compound Name | [(Z)-ethylideneamino] (E)-2-cyano-3-phenylprop-2-enoate |
| PubChem CID | 123644224 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | [(Z)-ethylideneamino] (E)-2-cyano-3-phenylprop-2-enoate |
| SMILES | C/C=N\OC(=O)/C(C#N)=C/c1ccccc1 |
| InChI | InChI=1S/C12H10N2O2/c1-2-14-16-12(15)11(9-13)8-10-6-4-3-5-7-10/h2-8H,1H3/b11-8+,14-2- |
| InChIKey | XWLAIEZDVDGWLC-MXGABRNNSA-N |
| XLogP | 2.14 |
| TPSA | 62.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-ethylideneamino] (E)-2-cyano-3-phenylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-ethylideneamino] (E)-2-cyano-3-phenylprop-2-enoate?
The IUPAC name of [(Z)-ethylideneamino] (E)-2-cyano-3-phenylprop-2-enoate (CID 123644224) is [(Z)-ethylideneamino] (E)-2-cyano-3-phenylprop-2-enoate.
What is the SMILES notation for [(Z)-ethylideneamino] (E)-2-cyano-3-phenylprop-2-enoate?
The canonical SMILES for [(Z)-ethylideneamino] (E)-2-cyano-3-phenylprop-2-enoate is C/C=N\OC(=O)/C(C#N)=C/c1ccccc1.
What is the InChIKey of [(Z)-ethylideneamino] (E)-2-cyano-3-phenylprop-2-enoate?
The InChIKey is XWLAIEZDVDGWLC-MXGABRNNSA-N. The full InChI is InChI=1S/C12H10N2O2/c1-2-14-16-12(15)11(9-13)8-10-6-4-3-5-7-10/h2-8H,1H3/b11-8+,14-2-.
What are the key properties of [(Z)-ethylideneamino] (E)-2-cyano-3-phenylprop-2-enoate?
[(Z)-ethylideneamino] (E)-2-cyano-3-phenylprop-2-enoate has a molecular weight of 214.22 g/mol, XLogP of 2.14, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-ethylideneamino] (E)-2-cyano-3-phenylprop-2-enoate is sourced from PubChem (CID 123644224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).