C31H27F3N4O6S — CID 123644667
[5-[4-(2-phenylacetyl)-1,4-diazepane-1-carbonyl]-2-(quinolin-8-ylsulfonylamino)phenyl] 2,2,2-trifluoroacetate (PubChem CID 123644667) has the molecular formula C31H27F3N4O6S and a molecular weight of 640.64 g/mol. Its IUPAC name is [5-[4-(2-phenylacetyl)-1,4-diazepane-1-carbonyl]-2-(quinolin-8-ylsulfonylamino)phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [5-[4-(2-phenylacetyl)-1,4-diazepane-1-carbonyl]-2-(quinolin-8-ylsulfonylamino)phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 123644667 |
| Molecular Formula | C31H27F3N4O6S |
| Molecular Weight | 640.64 g/mol |
| Exact Mass | 640.16 |
| IUPAC Name | [5-[4-(2-phenylacetyl)-1,4-diazepane-1-carbonyl]-2-(quinolin-8-ylsulfonylamino)phenyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(Cc1ccccc1)N1CCCN(C(=O)c2ccc(NS(=O)(=O)c3cccc4cccnc34)c(OC(=O)C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C31H27F3N4O6S/c32-31(33,34)30(41)44-25-20-23(12-13-24(25)36-45(42,43)26-11-4-9-22-10-5-14-35-28(22)26)29(40)38-16-6-15-37(17-18-38)27(39)19-21-7-2-1-3-8-21/h1-5,7-14,20,36H,6,15-19H2 |
| InChIKey | OMPNQSCIRZMVOE-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 125.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.64 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|