C12H16F3NO — CID 123644828
N,2-dimethyl-3-[4-(trifluoromethoxy)hexa-1,3,5-trien-2-yl]cyclopropan-1-amine (PubChem CID 123644828) has the molecular formula C12H16F3NO and a molecular weight of 247.26 g/mol. Its IUPAC name is N,2-dimethyl-3-[4-(trifluoromethoxy)hexa-1,3,5-trien-2-yl]cyclopropan-1-amine.
| Compound Name | N,2-dimethyl-3-[4-(trifluoromethoxy)hexa-1,3,5-trien-2-yl]cyclopropan-1-amine |
|---|---|
| PubChem CID | 123644828 |
| Molecular Formula | C12H16F3NO |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | N,2-dimethyl-3-[4-(trifluoromethoxy)hexa-1,3,5-trien-2-yl]cyclopropan-1-amine |
| SMILES | C=CC(=CC(=C)C1C(C)C1NC)OC(F)(F)F |
| InChI | InChI=1S/C12H16F3NO/c1-5-9(17-12(13,14)15)6-7(2)10-8(3)11(10)16-4/h5-6,8,10-11,16H,1-2H2,3-4H3 |
| InChIKey | NFHNKRHMEVSWMW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|