C10H16O2S — CID 123645413
5-(3-methylsulfinylpropyl)cyclohexa-2,4-dien-1-ol (PubChem CID 123645413) has the molecular formula C10H16O2S and a molecular weight of 200.30 g/mol. Its IUPAC name is 5-(3-methylsulfinylpropyl)cyclohexa-2,4-dien-1-ol.
| Compound Name | 5-(3-methylsulfinylpropyl)cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 123645413 |
| Molecular Formula | C10H16O2S |
| Molecular Weight | 200.30 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 5-(3-methylsulfinylpropyl)cyclohexa-2,4-dien-1-ol |
| SMILES | CS(=O)CCCC1=CC=CC(O)C1 |
| InChI | InChI=1S/C10H16O2S/c1-13(12)7-3-5-9-4-2-6-10(11)8-9/h2,4,6,10-11H,3,5,7-8H2,1H3 |
| InChIKey | LUTVHVPXKBYWNZ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |