C22H22N4O6 — CID 123645556
methyl 1-(3,5-dimethoxyphenyl)-2-hydroxy-5-imino-4-(1-methylbenzimidazol-2-yl)-3-oxopyrrolidine-2-carboxylate (PubChem CID 123645556) has the molecular formula C22H22N4O6 and a molecular weight of 438.44 g/mol. Its IUPAC name is methyl 1-(3,5-dimethoxyphenyl)-2-hydroxy-5-imino-4-(1-methylbenzimidazol-2-yl)-3-oxopyrrolidine-2-carboxylate.
| Compound Name | methyl 1-(3,5-dimethoxyphenyl)-2-hydroxy-5-imino-4-(1-methylbenzimidazol-2-yl)-3-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 123645556 |
| Molecular Formula | C22H22N4O6 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | methyl 1-(3,5-dimethoxyphenyl)-2-hydroxy-5-imino-4-(1-methylbenzimidazol-2-yl)-3-oxopyrrolidine-2-carboxylate |
| SMILES | [H]/N=C1/C(c2nc3ccccc3n2C)C(=O)C(O)(C(=O)OC)N1c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C22H22N4O6/c1-25-16-8-6-5-7-15(16)24-20(25)17-18(27)22(29,21(28)32-4)26(19(17)23)12-9-13(30-2)11-14(10-12)31-3/h5-11,17,23,29H,1-4H3/b23-19- |
| InChIKey | ZMXCONOTJKGCPR-NMWGTECJSA-N |
| XLogP | 1.60 |
| TPSA | 126.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|