C22H24N4O3 — CID 123281251
4-(1H-benzimidazol-2-yl)-1-(3,5-dimethoxyphenyl)-2-ethyl-5-imino-2-methylpyrrolidin-3-one (PubChem CID 123281251) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-yl)-1-(3,5-dimethoxyphenyl)-2-ethyl-5-imino-2-methylpyrrolidin-3-one.
| Compound Name | 4-(1H-benzimidazol-2-yl)-1-(3,5-dimethoxyphenyl)-2-ethyl-5-imino-2-methylpyrrolidin-3-one |
|---|---|
| PubChem CID | 123281251 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 4-(1H-benzimidazol-2-yl)-1-(3,5-dimethoxyphenyl)-2-ethyl-5-imino-2-methylpyrrolidin-3-one |
| SMILES | [H]/N=C1/C(c2nc3ccccc3[nH]2)C(=O)C(C)(CC)N1c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C22H24N4O3/c1-5-22(2)19(27)18(21-24-16-8-6-7-9-17(16)25-21)20(23)26(22)13-10-14(28-3)12-15(11-13)29-4/h6-12,18,23H,5H2,1-4H3,(H,24,25)/b23-20- |
| InChIKey | YJWQSQQBQBAKRH-ATJXCDBQSA-N |
| XLogP | 3.90 |
| TPSA | 91.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|