C25H24N4O4 — CID 123909622
4-(1H-benzimidazol-2-yl)-1-(3,5-dimethoxyphenyl)-2-(furan-2-yl)-2-methyl-5-methyliminopyrrolidin-3-one (PubChem CID 123909622) has the molecular formula C25H24N4O4 and a molecular weight of 444.49 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-yl)-1-(3,5-dimethoxyphenyl)-2-(furan-2-yl)-2-methyl-5-methyliminopyrrolidin-3-one.
| Compound Name | 4-(1H-benzimidazol-2-yl)-1-(3,5-dimethoxyphenyl)-2-(furan-2-yl)-2-methyl-5-methyliminopyrrolidin-3-one |
|---|---|
| PubChem CID | 123909622 |
| Molecular Formula | C25H24N4O4 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 4-(1H-benzimidazol-2-yl)-1-(3,5-dimethoxyphenyl)-2-(furan-2-yl)-2-methyl-5-methyliminopyrrolidin-3-one |
| SMILES | C/N=C1/C(c2nc3ccccc3[nH]2)C(=O)C(C)(c2ccco2)N1c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C25H24N4O4/c1-25(20-10-7-11-33-20)22(30)21(23-27-18-8-5-6-9-19(18)28-23)24(26-2)29(25)15-12-16(31-3)14-17(13-15)32-4/h5-14,21H,1-4H3,(H,27,28)/b26-24- |
| InChIKey | BZCUEYCHJBSHGL-LCUIJRPUSA-N |
| XLogP | 4.29 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|