C23H26N4O3 — CID 123703047
4-(1H-benzimidazol-2-yl)-1-(3,5-dimethoxyphenyl)-5-ethylimino-2,2-dimethylpyrrolidin-3-one (PubChem CID 123703047) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-yl)-1-(3,5-dimethoxyphenyl)-5-ethylimino-2,2-dimethylpyrrolidin-3-one.
| Compound Name | 4-(1H-benzimidazol-2-yl)-1-(3,5-dimethoxyphenyl)-5-ethylimino-2,2-dimethylpyrrolidin-3-one |
|---|---|
| PubChem CID | 123703047 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 4-(1H-benzimidazol-2-yl)-1-(3,5-dimethoxyphenyl)-5-ethylimino-2,2-dimethylpyrrolidin-3-one |
| SMILES | CC/N=C1\C(c2nc3ccccc3[nH]2)C(=O)C(C)(C)N1c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C23H26N4O3/c1-6-24-22-19(21-25-17-9-7-8-10-18(17)26-21)20(28)23(2,3)27(22)14-11-15(29-4)13-16(12-14)30-5/h7-13,19H,6H2,1-5H3,(H,25,26)/b24-22+ |
| InChIKey | PCVDMTFSRPUVRD-ZNTNEXAZSA-N |
| XLogP | 3.95 |
| TPSA | 79.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|