C24H28N4O4 — CID 123153794
4-(1H-benzimidazol-2-yl)-1-(3,5-dimethoxyphenyl)-2-(2-hydroxypropyl)-2-methyl-5-methyliminopyrrolidin-3-one (PubChem CID 123153794) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-yl)-1-(3,5-dimethoxyphenyl)-2-(2-hydroxypropyl)-2-methyl-5-methyliminopyrrolidin-3-one.
| Compound Name | 4-(1H-benzimidazol-2-yl)-1-(3,5-dimethoxyphenyl)-2-(2-hydroxypropyl)-2-methyl-5-methyliminopyrrolidin-3-one |
|---|---|
| PubChem CID | 123153794 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 4-(1H-benzimidazol-2-yl)-1-(3,5-dimethoxyphenyl)-2-(2-hydroxypropyl)-2-methyl-5-methyliminopyrrolidin-3-one |
| SMILES | C/N=C1/C(c2nc3ccccc3[nH]2)C(=O)C(C)(CC(C)O)N1c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C24H28N4O4/c1-14(29)13-24(2)21(30)20(22-26-18-8-6-7-9-19(18)27-22)23(25-3)28(24)15-10-16(31-4)12-17(11-15)32-5/h6-12,14,20,29H,13H2,1-5H3,(H,26,27)/b25-23- |
| InChIKey | PENIFFTVEPBTRE-BZZOAKBMSA-N |
| XLogP | 3.31 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|