C21H23N5O3 — CID 136608753
2-(2-aminoethyl)-4-(1H-benzimidazol-2-yl)-1-(3,5-dimethoxyphenyl)-5-imino-2H-pyrrol-3-ol (PubChem CID 136608753) has the molecular formula C21H23N5O3 and a molecular weight of 393.45 g/mol. Its IUPAC name is 2-(2-aminoethyl)-4-(1H-benzimidazol-2-yl)-1-(3,5-dimethoxyphenyl)-5-imino-2H-pyrrol-3-ol.
| Compound Name | 2-(2-aminoethyl)-4-(1H-benzimidazol-2-yl)-1-(3,5-dimethoxyphenyl)-5-imino-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 136608753 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 2-(2-aminoethyl)-4-(1H-benzimidazol-2-yl)-1-(3,5-dimethoxyphenyl)-5-imino-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc3ccccc3[nH]2)=C(O)C(CCN)N1c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C21H23N5O3/c1-28-13-9-12(10-14(11-13)29-2)26-17(7-8-22)19(27)18(20(26)23)21-24-15-5-3-4-6-16(15)25-21/h3-6,9-11,17,23,27H,7-8,22H2,1-2H3,(H,24,25)/b23-20- |
| InChIKey | NNFVNJAMZHBRIW-ATJXCDBQSA-N |
| XLogP | 3.06 |
| TPSA | 120.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|