C17H13BrN4O2 — CID 136702730
(2R)-4-(1H-benzimidazol-2-yl)-2-bromo-1-(3-hydroxyphenyl)-5-imino-2H-pyrrol-3-ol (PubChem CID 136702730) has the molecular formula C17H13BrN4O2 and a molecular weight of 385.22 g/mol. Its IUPAC name is (2R)-4-(1H-benzimidazol-2-yl)-2-bromo-1-(3-hydroxyphenyl)-5-imino-2H-pyrrol-3-ol.
| Compound Name | (2R)-4-(1H-benzimidazol-2-yl)-2-bromo-1-(3-hydroxyphenyl)-5-imino-2H-pyrrol-3-ol |
|---|---|
| PubChem CID | 136702730 |
| Molecular Formula | C17H13BrN4O2 |
| Molecular Weight | 385.22 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | (2R)-4-(1H-benzimidazol-2-yl)-2-bromo-1-(3-hydroxyphenyl)-5-imino-2H-pyrrol-3-ol |
| SMILES | [H]/N=C1/C(c2nc3ccccc3[nH]2)=C(O)[C@@H](Br)N1c1cccc(O)c1 |
| InChI | InChI=1S/C17H13BrN4O2/c18-15-14(24)13(17-20-11-6-1-2-7-12(11)21-17)16(19)22(15)9-4-3-5-10(23)8-9/h1-8,15,19,23-24H,(H,20,21)/b19-16-/t15-/m0/s1 |
| InChIKey | SCNBBMONTRWIDD-ZMEGLIOTSA-N |
| XLogP | 3.76 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.22 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|