C22H24N4O3 — CID 157468346
2-(2-aminoethyl)-4-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-5-iminopyrrolidin-3-one (PubChem CID 157468346) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is 2-(2-aminoethyl)-4-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-5-iminopyrrolidin-3-one.
| Compound Name | 2-(2-aminoethyl)-4-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-5-iminopyrrolidin-3-one |
|---|---|
| PubChem CID | 157468346 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 2-(2-aminoethyl)-4-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-5-iminopyrrolidin-3-one |
| SMILES | [H]/N=C1/C(=C2Cc3ccccc3N2)C(=O)C(CCN)N1c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C22H24N4O3/c1-28-15-10-14(11-16(12-15)29-2)26-19(7-8-23)21(27)20(22(26)24)18-9-13-5-3-4-6-17(13)25-18/h3-6,10-12,19,24-25H,7-9,23H2,1-2H3/b20-18?,24-22- |
| InChIKey | DBBFHOFWZIVWJI-FGRLMIIBSA-N |
| XLogP | 2.71 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|