C23H23N3O4 — CID 146734953
2-acetyl-4-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-5-methyliminopyrrolidin-3-one (PubChem CID 146734953) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is 2-acetyl-4-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-5-methyliminopyrrolidin-3-one.
| Compound Name | 2-acetyl-4-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-5-methyliminopyrrolidin-3-one |
|---|---|
| PubChem CID | 146734953 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 2-acetyl-4-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-5-methyliminopyrrolidin-3-one |
| SMILES | C/N=C1/C(=C2Cc3ccccc3N2)C(=O)C(C(C)=O)N1c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C23H23N3O4/c1-13(27)21-22(28)20(19-9-14-7-5-6-8-18(14)25-19)23(24-2)26(21)15-10-16(29-3)12-17(11-15)30-4/h5-8,10-12,21,25H,9H2,1-4H3/b20-19?,24-23- |
| InChIKey | YZSHLUPUBQMORJ-ADGDINCDSA-N |
| XLogP | 3.00 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|