C26H30N4O4 — CID 146818109
4-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-5-imino-2-(2-morpholin-4-ylethyl)pyrrolidin-3-one (PubChem CID 146818109) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is 4-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-5-imino-2-(2-morpholin-4-ylethyl)pyrrolidin-3-one.
| Compound Name | 4-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-5-imino-2-(2-morpholin-4-ylethyl)pyrrolidin-3-one |
|---|---|
| PubChem CID | 146818109 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 4-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-5-imino-2-(2-morpholin-4-ylethyl)pyrrolidin-3-one |
| SMILES | [H]/N=C1/C(=C2Cc3ccccc3N2)C(=O)C(CCN2CCOCC2)N1c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C26H30N4O4/c1-32-19-14-18(15-20(16-19)33-2)30-23(7-8-29-9-11-34-12-10-29)25(31)24(26(30)27)22-13-17-5-3-4-6-21(17)28-22/h3-6,14-16,23,27-28H,7-13H2,1-2H3/b24-22?,27-26- |
| InChIKey | LVKXCWKDOASZIG-FNXHQMQNSA-N |
| XLogP | 3.08 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|