C22H21N3O3 — CID 146724943
6-(1,3-dihydroindol-2-ylidene)-4-(3,5-dimethoxyphenyl)-5-imino-4-azaspiro[2.4]heptan-7-one (PubChem CID 146724943) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is 6-(1,3-dihydroindol-2-ylidene)-4-(3,5-dimethoxyphenyl)-5-imino-4-azaspiro[2.4]heptan-7-one.
| Compound Name | 6-(1,3-dihydroindol-2-ylidene)-4-(3,5-dimethoxyphenyl)-5-imino-4-azaspiro[2.4]heptan-7-one |
|---|---|
| PubChem CID | 146724943 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 6-(1,3-dihydroindol-2-ylidene)-4-(3,5-dimethoxyphenyl)-5-imino-4-azaspiro[2.4]heptan-7-one |
| SMILES | [H]/N=C1/C(=C2Cc3ccccc3N2)C(=O)C2(CC2)N1c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C22H21N3O3/c1-27-15-10-14(11-16(12-15)28-2)25-21(23)19(20(26)22(25)7-8-22)18-9-13-5-3-4-6-17(13)24-18/h3-6,10-12,23-24H,7-9H2,1-2H3/b19-18?,23-21- |
| InChIKey | FGBRGGBXXZIFMS-VPIDQFHDSA-N |
| XLogP | 3.53 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|