C25H28N4O4 — CID 146738038
N-[2-[(2R)-4-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-5-imino-2-methyl-3-oxopyrrolidin-2-yl]ethyl]acetamide (PubChem CID 146738038) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is N-[2-[(2R)-4-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-5-imino-2-methyl-3-oxopyrrolidin-2-yl]ethyl]acetamide.
| Compound Name | N-[2-[(2R)-4-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-5-imino-2-methyl-3-oxopyrrolidin-2-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 146738038 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | N-[2-[(2R)-4-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-5-imino-2-methyl-3-oxopyrrolidin-2-yl]ethyl]acetamide |
| SMILES | [H]/N=C1/C(=C2Cc3ccccc3N2)C(=O)[C@@](C)(CCNC(C)=O)N1c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C25H28N4O4/c1-15(30)27-10-9-25(2)23(31)22(21-11-16-7-5-6-8-20(16)28-21)24(26)29(25)17-12-18(32-3)14-19(13-17)33-4/h5-8,12-14,26,28H,9-11H2,1-4H3,(H,27,30)/b22-21?,26-24-/t25-/m1/s1 |
| InChIKey | WZBDTYPICAWLDT-DTPHTMDDSA-N |
| XLogP | 3.28 |
| TPSA | 103.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|