C25H28N4O3 — CID 146800316
3-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-2-imino-8-methyl-1,8-diazaspiro[4.5]decan-4-one (PubChem CID 146800316) has the molecular formula C25H28N4O3 and a molecular weight of 432.52 g/mol. Its IUPAC name is 3-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-2-imino-8-methyl-1,8-diazaspiro[4.5]decan-4-one.
| Compound Name | 3-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-2-imino-8-methyl-1,8-diazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 146800316 |
| Molecular Formula | C25H28N4O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 3-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-2-imino-8-methyl-1,8-diazaspiro[4.5]decan-4-one |
| SMILES | [H]/N=C1\C(=C2Cc3ccccc3N2)C(=O)C2(CCN(C)CC2)N1c1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C25H28N4O3/c1-28-10-8-25(9-11-28)23(30)22(21-12-16-6-4-5-7-20(16)27-21)24(26)29(25)17-13-18(31-2)15-19(14-17)32-3/h4-7,13-15,26-27H,8-12H2,1-3H3/b22-21?,26-24+ |
| InChIKey | LMWOHOBOISNWQW-UJICDTBCSA-N |
| XLogP | 3.46 |
| TPSA | 77.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|