C31H33N3O5 — CID 146850638
4-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-5-[(3,5-dimethoxyphenyl)methylimino]-2,2-dimethylpyrrolidin-3-one (PubChem CID 146850638) has the molecular formula C31H33N3O5 and a molecular weight of 527.62 g/mol. Its IUPAC name is 4-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-5-[(3,5-dimethoxyphenyl)methylimino]-2,2-dimethylpyrrolidin-3-one.
| Compound Name | 4-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-5-[(3,5-dimethoxyphenyl)methylimino]-2,2-dimethylpyrrolidin-3-one |
|---|---|
| PubChem CID | 146850638 |
| Molecular Formula | C31H33N3O5 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | 4-(1,3-dihydroindol-2-ylidene)-1-(3,5-dimethoxyphenyl)-5-[(3,5-dimethoxyphenyl)methylimino]-2,2-dimethylpyrrolidin-3-one |
| SMILES | COc1cc(C/N=C2/C(=C3Cc4ccccc4N3)C(=O)C(C)(C)N2c2cc(OC)cc(OC)c2)cc(OC)c1 |
| InChI | InChI=1S/C31H33N3O5/c1-31(2)29(35)28(27-13-20-9-7-8-10-26(20)33-27)30(32-18-19-11-22(36-3)16-23(12-19)37-4)34(31)21-14-24(38-5)17-25(15-21)39-6/h7-12,14-17,33H,13,18H2,1-6H3/b28-27?,32-30- |
| InChIKey | NGRLLJOMTBVGHF-MQMGMSGBSA-N |
| XLogP | 5.41 |
| TPSA | 81.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|