C9H15NOS — CID 123646007
1-(4-methyl-5-propan-2-yl-1,2-oxazol-3-yl)ethanethiol (PubChem CID 123646007) has the molecular formula C9H15NOS and a molecular weight of 185.29 g/mol. Its IUPAC name is 1-(4-methyl-5-propan-2-yl-1,2-oxazol-3-yl)ethanethiol.
| Compound Name | 1-(4-methyl-5-propan-2-yl-1,2-oxazol-3-yl)ethanethiol |
|---|---|
| PubChem CID | 123646007 |
| Molecular Formula | C9H15NOS |
| Molecular Weight | 185.29 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | 1-(4-methyl-5-propan-2-yl-1,2-oxazol-3-yl)ethanethiol |
| SMILES | Cc1c(C(C)S)noc1C(C)C |
| InChI | InChI=1S/C9H15NOS/c1-5(2)9-6(3)8(7(4)12)10-11-9/h5,7,12H,1-4H3 |
| InChIKey | KDJLVWBIPZBPCD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 26.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|