C22H33N3O — CID 123646617
N'-[(4-methylphenyl)methyl]-N-[2-oxo-2-(3-pent-1-en-2-ylpiperidin-1-yl)ethyl]ethanimidamide (PubChem CID 123646617) has the molecular formula C22H33N3O and a molecular weight of 355.53 g/mol. Its IUPAC name is N'-[(4-methylphenyl)methyl]-N-[2-oxo-2-(3-pent-1-en-2-ylpiperidin-1-yl)ethyl]ethanimidamide.
| Compound Name | N'-[(4-methylphenyl)methyl]-N-[2-oxo-2-(3-pent-1-en-2-ylpiperidin-1-yl)ethyl]ethanimidamide |
|---|---|
| PubChem CID | 123646617 |
| Molecular Formula | C22H33N3O |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.26 |
| IUPAC Name | N'-[(4-methylphenyl)methyl]-N-[2-oxo-2-(3-pent-1-en-2-ylpiperidin-1-yl)ethyl]ethanimidamide |
| SMILES | C=C(CCC)C1CCCN(C(=O)CN/C(C)=N/Cc2ccc(C)cc2)C1 |
| InChI | InChI=1S/C22H33N3O/c1-5-7-18(3)21-8-6-13-25(16-21)22(26)15-24-19(4)23-14-20-11-9-17(2)10-12-20/h9-12,21H,3,5-8,13-16H2,1-2,4H3,(H,23,24) |
| InChIKey | ZHIYVIGLFCBDIN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|