C14H18N4O2S — CID 123649232
2-hydroxy-5-[[2-(3-methylpiperidin-1-yl)pyrimidin-4-yl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 123649232) has the molecular formula C14H18N4O2S and a molecular weight of 306.39 g/mol. Its IUPAC name is 2-hydroxy-5-[[2-(3-methylpiperidin-1-yl)pyrimidin-4-yl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 2-hydroxy-5-[[2-(3-methylpiperidin-1-yl)pyrimidin-4-yl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 123649232 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-hydroxy-5-[[2-(3-methylpiperidin-1-yl)pyrimidin-4-yl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | CC1CCCN(c2nccc(C=C3SC(O)NC3=O)n2)C1 |
| InChI | InChI=1S/C14H18N4O2S/c1-9-3-2-6-18(8-9)13-15-5-4-10(16-13)7-11-12(19)17-14(20)21-11/h4-5,7,9,14,20H,2-3,6,8H2,1H3,(H,17,19) |
| InChIKey | OZFPVZCUFPYYTG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|