C23H32N6 — CID 123650450
N'-(3-tert-butylphenyl)-N-[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-3-yl]ethane-1,2-diamine (PubChem CID 123650450) has the molecular formula C23H32N6 and a molecular weight of 392.55 g/mol. Its IUPAC name is N'-(3-tert-butylphenyl)-N-[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-3-yl]ethane-1,2-diamine.
| Compound Name | N'-(3-tert-butylphenyl)-N-[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-3-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 123650450 |
| Molecular Formula | C23H32N6 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | N'-(3-tert-butylphenyl)-N-[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-3-yl]ethane-1,2-diamine |
| SMILES | CC(C)(C)c1cccc(NCCNC2CCCN(c3ncnc4[nH]ccc34)C2)c1 |
| InChI | InChI=1S/C23H32N6/c1-23(2,3)17-6-4-7-18(14-17)24-11-12-25-19-8-5-13-29(15-19)22-20-9-10-26-21(20)27-16-28-22/h4,6-7,9-10,14,16,19,24-25H,5,8,11-13,15H2,1-3H3,(H,26,27,28) |
| InChIKey | ZCWSJXQVXJCEMQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|