C20H19F3N8 — CID 88536494
1-cyano-2-[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-3-yl]-3-[3-(trifluoromethyl)phenyl]guanidine (PubChem CID 88536494) has the molecular formula C20H19F3N8 and a molecular weight of 428.42 g/mol. Its IUPAC name is 1-cyano-2-[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-3-yl]-3-[3-(trifluoromethyl)phenyl]guanidine.
| Compound Name | 1-cyano-2-[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-3-yl]-3-[3-(trifluoromethyl)phenyl]guanidine |
|---|---|
| PubChem CID | 88536494 |
| Molecular Formula | C20H19F3N8 |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 1-cyano-2-[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperidin-3-yl]-3-[3-(trifluoromethyl)phenyl]guanidine |
| SMILES | N#CN/C(=N\C1CCCN(c2ncnc3[nH]ccc23)C1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H19F3N8/c21-20(22,23)13-3-1-4-14(9-13)29-19(26-11-24)30-15-5-2-8-31(10-15)18-16-6-7-25-17(16)27-12-28-18/h1,3-4,6-7,9,12,15H,2,5,8,10H2,(H,25,27,28)(H2,26,29,30) |
| InChIKey | HDSNMOBIWCMCBK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|