C13H24 — CID 123651388
6-ethyl-3,7-dimethyl-5-methylideneoct-1-ene (PubChem CID 123651388) has the molecular formula C13H24 and a molecular weight of 180.33 g/mol. Its IUPAC name is 6-ethyl-3,7-dimethyl-5-methylideneoct-1-ene.
| Compound Name | 6-ethyl-3,7-dimethyl-5-methylideneoct-1-ene |
|---|---|
| PubChem CID | 123651388 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | 6-ethyl-3,7-dimethyl-5-methylideneoct-1-ene |
| SMILES | C=CC(C)CC(=C)C(CC)C(C)C |
| InChI | InChI=1S/C13H24/c1-7-11(5)9-12(6)13(8-2)10(3)4/h7,10-11,13H,1,6,8-9H2,2-5H3 |
| InChIKey | JYGRPVUJAOVSQO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|