About 3-ethyl-N-ethynyl-2,2,6-trimethyloct-7-en-4-imine
3-ethyl-N-ethynyl-2,2,6-trimethyloct-7-en-4-imine (PubChem CID 137412467) has the molecular formula C15H25N
and a molecular weight of 219.37 g/mol. Its IUPAC name is 3-ethyl-N-ethynyl-2,2,6-trimethyloct-7-en-4-imine.
Molecular Properties
| Compound Name | 3-ethyl-N-ethynyl-2,2,6-trimethyloct-7-en-4-imine |
| PubChem CID | 137412467 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 3-ethyl-N-ethynyl-2,2,6-trimethyloct-7-en-4-imine |
| SMILES | C#C/N=C(\CC(C)C=C)C(CC)C(C)(C)C |
| InChI | InChI=1S/C15H25N/c1-8-12(4)11-14(16-10-3)13(9-2)15(5,6)7/h3,8,12-13H,1,9,11H2,2,4-7H3/b16-14+ |
| InChIKey | HMXZDBWBMKLMKU-JQIJEIRASA-N |
| XLogP | 4.30 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-N-ethynyl-2,2,6-trimethyloct-7-en-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-N-ethynyl-2,2,6-trimethyloct-7-en-4-imine?
The IUPAC name of 3-ethyl-N-ethynyl-2,2,6-trimethyloct-7-en-4-imine (CID 137412467) is 3-ethyl-N-ethynyl-2,2,6-trimethyloct-7-en-4-imine.
What is the SMILES notation for 3-ethyl-N-ethynyl-2,2,6-trimethyloct-7-en-4-imine?
The canonical SMILES for 3-ethyl-N-ethynyl-2,2,6-trimethyloct-7-en-4-imine is C#C/N=C(\CC(C)C=C)C(CC)C(C)(C)C.
What is the InChIKey of 3-ethyl-N-ethynyl-2,2,6-trimethyloct-7-en-4-imine?
The InChIKey is HMXZDBWBMKLMKU-JQIJEIRASA-N. The full InChI is InChI=1S/C15H25N/c1-8-12(4)11-14(16-10-3)13(9-2)15(5,6)7/h3,8,12-13H,1,9,11H2,2,4-7H3/b16-14+.
What are the key properties of 3-ethyl-N-ethynyl-2,2,6-trimethyloct-7-en-4-imine?
3-ethyl-N-ethynyl-2,2,6-trimethyloct-7-en-4-imine has a molecular weight of 219.37 g/mol, XLogP of 4.30, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-N-ethynyl-2,2,6-trimethyloct-7-en-4-imine is sourced from PubChem (CID 137412467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).