C11H19N — CID 129068165
N-ethynyl-2,6-dimethylheptan-3-imine (PubChem CID 129068165) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is N-ethynyl-2,6-dimethylheptan-3-imine.
| Compound Name | N-ethynyl-2,6-dimethylheptan-3-imine |
|---|---|
| PubChem CID | 129068165 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | N-ethynyl-2,6-dimethylheptan-3-imine |
| SMILES | C#C/N=C(\CCC(C)C)C(C)C |
| InChI | InChI=1S/C11H19N/c1-6-12-11(10(4)5)8-7-9(2)3/h1,9-10H,7-8H2,2-5H3/b12-11+ |
| InChIKey | HWRBQGOGTATPBB-VAWYXSNFSA-N |
| XLogP | 3.11 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|