About N-ethynylpropan-2-imine
N-ethynylpropan-2-imine (PubChem CID 18737205) has the molecular formula C5H7N
and a molecular weight of 81.12 g/mol. Its IUPAC name is N-ethynylpropan-2-imine.
Molecular Properties
| Compound Name | N-ethynylpropan-2-imine |
| PubChem CID | 18737205 |
| Molecular Formula | C5H7N |
| Molecular Weight | 81.12 g/mol |
| Exact Mass | 81.06 |
| IUPAC Name | N-ethynylpropan-2-imine |
| SMILES | C#CN=C(C)C |
| InChI | InChI=1S/C5H7N/c1-4-6-5(2)3/h1H,2-3H3 |
| InChIKey | LBTCHZWVZMKXGE-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 81.12 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethynylpropan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethynylpropan-2-imine?
The IUPAC name of N-ethynylpropan-2-imine (CID 18737205) is N-ethynylpropan-2-imine.
What is the SMILES notation for N-ethynylpropan-2-imine?
The canonical SMILES for N-ethynylpropan-2-imine is C#CN=C(C)C.
What is the InChIKey of N-ethynylpropan-2-imine?
The InChIKey is LBTCHZWVZMKXGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N/c1-4-6-5(2)3/h1H,2-3H3.
What are the key properties of N-ethynylpropan-2-imine?
N-ethynylpropan-2-imine has a molecular weight of 81.12 g/mol, XLogP of 1.06, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethynylpropan-2-imine is sourced from PubChem (CID 18737205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).