About CID 58611583
CID 58611583 (PubChem CID 58611583) has the molecular formula C5H10N2
and a molecular weight of 98.15 g/mol.
Molecular Properties
| Compound Name | CID 58611583 |
| PubChem CID | 58611583 |
| Molecular Formula | C5H10N2 |
| Molecular Weight | 98.15 g/mol |
| Exact Mass | 98.08 |
| IUPAC Name | — |
| SMILES | [CH]N(C)N=C(C)C |
| InChI | InChI=1S/C5H10N2/c1-5(2)6-7(3)4/h3H,1-2,4H3 |
| InChIKey | BDFKLIPYJKQPEI-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.15 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 58611583 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58611583?
The IUPAC name of CID 58611583 (CID 58611583) is not available.
What is the SMILES notation for CID 58611583?
The canonical SMILES for CID 58611583 is [CH]N(C)N=C(C)C.
What is the InChIKey of CID 58611583?
The InChIKey is BDFKLIPYJKQPEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2/c1-5(2)6-7(3)4/h3H,1-2,4H3.
What are the key properties of CID 58611583?
CID 58611583 has a molecular weight of 98.15 g/mol, XLogP of 0.98, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58611583 is sourced from PubChem (CID 58611583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).