C6H14N2 — CID 21338698
N,N-dimethyl-1-(propan-2-ylideneamino)methanamine (PubChem CID 21338698) has the molecular formula C6H14N2 and a molecular weight of 114.19 g/mol. Its IUPAC name is N,N-dimethyl-1-(propan-2-ylideneamino)methanamine.
| Compound Name | N,N-dimethyl-1-(propan-2-ylideneamino)methanamine |
|---|---|
| PubChem CID | 21338698 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | N,N-dimethyl-1-(propan-2-ylideneamino)methanamine |
| SMILES | CC(C)=NCN(C)C |
| InChI | InChI=1S/C6H14N2/c1-6(2)7-5-8(3)4/h5H2,1-4H3 |
| InChIKey | WSTWHTMRKNXGFK-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|