C7H14N2 — CID 142890314
(E)-N,2-dimethyl-N-(methylideneamino)but-2-en-1-amine (PubChem CID 142890314) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is (E)-N,2-dimethyl-N-(methylideneamino)but-2-en-1-amine.
| Compound Name | (E)-N,2-dimethyl-N-(methylideneamino)but-2-en-1-amine |
|---|---|
| PubChem CID | 142890314 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | (E)-N,2-dimethyl-N-(methylideneamino)but-2-en-1-amine |
| SMILES | C=NN(C)C/C(C)=C/C |
| InChI | InChI=1S/C7H14N2/c1-5-7(2)6-9(4)8-3/h5H,3,6H2,1-2,4H3/b7-5+ |
| InChIKey | BEQOAZXZATVJIU-FNORWQNLSA-N |
| XLogP | 1.50 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|