C30H50FN3S — CID 142890312
(1R,10S)-N-butylsulfanyl-5-ethyltricyclo[8.2.1.03,8]trideca-3(8),4,6-trien-13-amine;(E)-N,2-dimethyl-N-(methylideneamino)but-2-en-1-amine;3-fluorobut-1-ene (PubChem CID 142890312) has the molecular formula C30H50FN3S and a molecular weight of 503.82 g/mol. Its IUPAC name is (1R,10S)-N-butylsulfanyl-5-ethyltricyclo[8.2.1.03,8]trideca-3(8),4,6-trien-13-amine;(E)-N,2-dimethyl-N-(methylideneamino)but-2-en-1-amine;3-fluorobut-1-ene.
| Compound Name | (1R,10S)-N-butylsulfanyl-5-ethyltricyclo[8.2.1.03,8]trideca-3(8),4,6-trien-13-amine;(E)-N,2-dimethyl-N-(methylideneamino)but-2-en-1-amine;3-fluorobut-1-ene |
|---|---|
| PubChem CID | 142890312 |
| Molecular Formula | C30H50FN3S |
| Molecular Weight | 503.82 g/mol |
| Exact Mass | 503.37 |
| IUPAC Name | (1R,10S)-N-butylsulfanyl-5-ethyltricyclo[8.2.1.03,8]trideca-3(8),4,6-trien-13-amine;(E)-N,2-dimethyl-N-(methylideneamino)but-2-en-1-amine;3-fluorobut-1-ene |
| SMILES | C=CC(C)F.C=NN(C)C/C(C)=C/C.CCCCSNC1[C@@H]2CC[C@H]1Cc1ccc(CC)cc1C2 |
| InChI | InChI=1S/C19H29NS.C7H14N2.C4H7F/c1-3-5-10-21-20-19-16-8-9-17(19)13-18-11-14(4-2)6-7-15(18)12-16;1-5-7(2)6-9(4)8-3;1-3-4(2)5/h6-7,11,16-17,19-20H,3-5,8-10,12-13H2,1-2H3;5H,3,6H2,1-2,4H3;3-4H,1H2,2H3/b;7-5+;/t16-,17+,19?;;/m0../s1 |
| InChIKey | WOSDGOIPWGWQKM-BWRHNTCQSA-N |
| XLogP | 7.81 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.82 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|