About 2-methyl-N,N-bis(prop-2-enyl)but-2-en-1-amine
2-methyl-N,N-bis(prop-2-enyl)but-2-en-1-amine (PubChem CID 87439385) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is 2-methyl-N,N-bis(prop-2-enyl)but-2-en-1-amine.
Molecular Properties
| Compound Name | 2-methyl-N,N-bis(prop-2-enyl)but-2-en-1-amine |
| PubChem CID | 87439385 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 2-methyl-N,N-bis(prop-2-enyl)but-2-en-1-amine |
| SMILES | C=CCN(CC=C)CC(C)=CC |
| InChI | InChI=1S/C11H19N/c1-5-8-12(9-6-2)10-11(4)7-3/h5-7H,1-2,8-10H2,3-4H3 |
| InChIKey | HGQJBDRDOLCXIV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N,N-bis(prop-2-enyl)but-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N,N-bis(prop-2-enyl)but-2-en-1-amine?
The IUPAC name of 2-methyl-N,N-bis(prop-2-enyl)but-2-en-1-amine (CID 87439385) is 2-methyl-N,N-bis(prop-2-enyl)but-2-en-1-amine.
What is the SMILES notation for 2-methyl-N,N-bis(prop-2-enyl)but-2-en-1-amine?
The canonical SMILES for 2-methyl-N,N-bis(prop-2-enyl)but-2-en-1-amine is C=CCN(CC=C)CC(C)=CC.
What is the InChIKey of 2-methyl-N,N-bis(prop-2-enyl)but-2-en-1-amine?
The InChIKey is HGQJBDRDOLCXIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N/c1-5-8-12(9-6-2)10-11(4)7-3/h5-7H,1-2,8-10H2,3-4H3.
What are the key properties of 2-methyl-N,N-bis(prop-2-enyl)but-2-en-1-amine?
2-methyl-N,N-bis(prop-2-enyl)but-2-en-1-amine has a molecular weight of 165.28 g/mol, XLogP of 2.63, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N,N-bis(prop-2-enyl)but-2-en-1-amine is sourced from PubChem (CID 87439385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).