C8H18NY- — CID 58133141
carbanide;N,N,2-trimethylbut-2-en-1-amine;yttrium (PubChem CID 58133141) has the molecular formula C8H18NY- and a molecular weight of 217.15 g/mol. Its IUPAC name is carbanide;N,N,2-trimethylbut-2-en-1-amine;yttrium.
| Compound Name | carbanide;N,N,2-trimethylbut-2-en-1-amine;yttrium |
|---|---|
| PubChem CID | 58133141 |
| Molecular Formula | C8H18NY- |
| Molecular Weight | 217.15 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | carbanide;N,N,2-trimethylbut-2-en-1-amine;yttrium |
| SMILES | CC=C(C)CN(C)C.[CH3-].[Y] |
| InChI | InChI=1S/C7H15N.CH3.Y/c1-5-7(2)6-8(3)4;;/h5H,6H2,1-4H3;1H3;/q;-1; |
| InChIKey | HAPITTZVCOWQDO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.15 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|