C5H11NO2 — CID 89182379
3-(dimethylamino)prop-1-ene-1,2-diol (PubChem CID 89182379) has the molecular formula C5H11NO2 and a molecular weight of 117.15 g/mol. Its IUPAC name is 3-(dimethylamino)prop-1-ene-1,2-diol.
| Compound Name | 3-(dimethylamino)prop-1-ene-1,2-diol |
|---|---|
| PubChem CID | 89182379 |
| Molecular Formula | C5H11NO2 |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.08 |
| IUPAC Name | 3-(dimethylamino)prop-1-ene-1,2-diol |
| SMILES | CN(C)CC(O)=CO |
| InChI | InChI=1S/C5H11NO2/c1-6(2)3-5(8)4-7/h4,7-8H,3H2,1-2H3 |
| InChIKey | ZYTXNBOTSQTUHJ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|