C3H5FO2 — CID 157010878
(Z)-3-fluoroprop-1-ene-1,2-diol (PubChem CID 157010878) has the molecular formula C3H5FO2 and a molecular weight of 92.07 g/mol. Its IUPAC name is (Z)-3-fluoroprop-1-ene-1,2-diol.
| Compound Name | (Z)-3-fluoroprop-1-ene-1,2-diol |
|---|---|
| PubChem CID | 157010878 |
| Molecular Formula | C3H5FO2 |
| Molecular Weight | 92.07 g/mol |
| Exact Mass | 92.03 |
| IUPAC Name | (Z)-3-fluoroprop-1-ene-1,2-diol |
| SMILES | O/C=C(\O)CF |
| InChI | InChI=1S/C3H5FO2/c4-1-3(6)2-5/h2,5-6H,1H2/b3-2- |
| InChIKey | BLXWXMDAHCKPKY-IHWYPQMZSA-N |
| XLogP | 0.91 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 92.07 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|