About 2-fluoroacetic acid;hydrochloride
2-fluoroacetic acid;hydrochloride (PubChem CID 87782456) has the molecular formula C2H4ClFO2
and a molecular weight of 114.50 g/mol. Its IUPAC name is 2-fluoroacetic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-fluoroacetic acid;hydrochloride |
| PubChem CID | 87782456 |
| Molecular Formula | C2H4ClFO2 |
| Molecular Weight | 114.50 g/mol |
| Exact Mass | 113.99 |
| IUPAC Name | 2-fluoroacetic acid;hydrochloride |
| SMILES | Cl.O=C(O)CF |
| InChI | InChI=1S/C2H3FO2.ClH/c3-1-2(4)5;/h1H2,(H,4,5);1H |
| InChIKey | XECFZCZBDBNECM-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.50 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-fluoroacetic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoroacetic acid;hydrochloride?
The IUPAC name of 2-fluoroacetic acid;hydrochloride (CID 87782456) is 2-fluoroacetic acid;hydrochloride.
What is the SMILES notation for 2-fluoroacetic acid;hydrochloride?
The canonical SMILES for 2-fluoroacetic acid;hydrochloride is Cl.O=C(O)CF.
What is the InChIKey of 2-fluoroacetic acid;hydrochloride?
The InChIKey is XECFZCZBDBNECM-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3FO2.ClH/c3-1-2(4)5;/h1H2,(H,4,5);1H.
What are the key properties of 2-fluoroacetic acid;hydrochloride?
2-fluoroacetic acid;hydrochloride has a molecular weight of 114.50 g/mol, XLogP of 0.46, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroacetic acid;hydrochloride is sourced from PubChem (CID 87782456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).