C6H12O3 — CID 21486162
(Z)-hex-1-ene-1,2,6-triol (PubChem CID 21486162) has the molecular formula C6H12O3 and a molecular weight of 132.16 g/mol. Its IUPAC name is (Z)-hex-1-ene-1,2,6-triol.
| Compound Name | (Z)-hex-1-ene-1,2,6-triol |
|---|---|
| PubChem CID | 21486162 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | (Z)-hex-1-ene-1,2,6-triol |
| SMILES | O/C=C(\O)CCCCO |
| InChI | InChI=1S/C6H12O3/c7-4-2-1-3-6(9)5-8/h5,7-9H,1-4H2/b6-5- |
| InChIKey | RTUQKZCBZBMIAA-WAYWQWQTSA-N |
| XLogP | 1.11 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|