C9H20FN — CID 171096526
ethane;(E)-2-(fluoromethyl)-N,N-dimethylbut-2-en-1-amine (PubChem CID 171096526) has the molecular formula C9H20FN and a molecular weight of 161.26 g/mol. Its IUPAC name is ethane;(E)-2-(fluoromethyl)-N,N-dimethylbut-2-en-1-amine.
| Compound Name | ethane;(E)-2-(fluoromethyl)-N,N-dimethylbut-2-en-1-amine |
|---|---|
| PubChem CID | 171096526 |
| Molecular Formula | C9H20FN |
| Molecular Weight | 161.26 g/mol |
| Exact Mass | 161.16 |
| IUPAC Name | ethane;(E)-2-(fluoromethyl)-N,N-dimethylbut-2-en-1-amine |
| SMILES | C/C=C(/CF)CN(C)C.CC |
| InChI | InChI=1S/C7H14FN.C2H6/c1-4-7(5-8)6-9(2)3;1-2/h4H,5-6H2,1-3H3;1-2H3/b7-4-; |
| InChIKey | HQDQQOXQVPGJAP-ZULQGGHCSA-N |
| XLogP | 2.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.26 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|