About methane;N-methyl-2-(propan-2-ylideneamino)-N-[(propan-2-ylideneamino)methyl]ethanamine
methane;N-methyl-2-(propan-2-ylideneamino)-N-[(propan-2-ylideneamino)methyl]ethanamine (PubChem CID 159396236) has the molecular formula C11H25N3
and a molecular weight of 199.34 g/mol. Its IUPAC name is methane;N-methyl-2-(propan-2-ylideneamino)-N-[(propan-2-ylideneamino)methyl]ethanamine.
Molecular Properties
| Compound Name | methane;N-methyl-2-(propan-2-ylideneamino)-N-[(propan-2-ylideneamino)methyl]ethanamine |
| PubChem CID | 159396236 |
| Molecular Formula | C11H25N3 |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.20 |
| IUPAC Name | methane;N-methyl-2-(propan-2-ylideneamino)-N-[(propan-2-ylideneamino)methyl]ethanamine |
| SMILES | C.CC(C)=NCCN(C)CN=C(C)C |
| InChI | InChI=1S/C10H21N3.CH4/c1-9(2)11-6-7-13(5)8-12-10(3)4;/h6-8H2,1-5H3;1H4 |
| InChIKey | LMTDTHAXUXIBPX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methane;N-methyl-2-(propan-2-ylideneamino)-N-[(propan-2-ylideneamino)methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;N-methyl-2-(propan-2-ylideneamino)-N-[(propan-2-ylideneamino)methyl]ethanamine?
The IUPAC name of methane;N-methyl-2-(propan-2-ylideneamino)-N-[(propan-2-ylideneamino)methyl]ethanamine (CID 159396236) is methane;N-methyl-2-(propan-2-ylideneamino)-N-[(propan-2-ylideneamino)methyl]ethanamine.
What is the SMILES notation for methane;N-methyl-2-(propan-2-ylideneamino)-N-[(propan-2-ylideneamino)methyl]ethanamine?
The canonical SMILES for methane;N-methyl-2-(propan-2-ylideneamino)-N-[(propan-2-ylideneamino)methyl]ethanamine is C.CC(C)=NCCN(C)CN=C(C)C.
What is the InChIKey of methane;N-methyl-2-(propan-2-ylideneamino)-N-[(propan-2-ylideneamino)methyl]ethanamine?
The InChIKey is LMTDTHAXUXIBPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N3.CH4/c1-9(2)11-6-7-13(5)8-12-10(3)4;/h6-8H2,1-5H3;1H4.
What are the key properties of methane;N-methyl-2-(propan-2-ylideneamino)-N-[(propan-2-ylideneamino)methyl]ethanamine?
methane;N-methyl-2-(propan-2-ylideneamino)-N-[(propan-2-ylideneamino)methyl]ethanamine has a molecular weight of 199.34 g/mol, XLogP of 2.47, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;N-methyl-2-(propan-2-ylideneamino)-N-[(propan-2-ylideneamino)methyl]ethanamine is sourced from PubChem (CID 159396236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).