About 1-[N'-[[ethyl(methyl)amino]methyl]carbamimidoyl]-3-propan-2-ylideneguanidine
1-[N'-[[ethyl(methyl)amino]methyl]carbamimidoyl]-3-propan-2-ylideneguanidine (PubChem CID 176522076) has the molecular formula C9H20N6
and a molecular weight of 212.30 g/mol. Its IUPAC name is 1-[N'-[[ethyl(methyl)amino]methyl]carbamimidoyl]-3-propan-2-ylideneguanidine.
Molecular Properties
| Compound Name | 1-[N'-[[ethyl(methyl)amino]methyl]carbamimidoyl]-3-propan-2-ylideneguanidine |
| PubChem CID | 176522076 |
| Molecular Formula | C9H20N6 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.17 |
| IUPAC Name | 1-[N'-[[ethyl(methyl)amino]methyl]carbamimidoyl]-3-propan-2-ylideneguanidine |
| SMILES | [H]/N=C(\N=C(C)C)NC(N)=NCN(C)CC |
| InChI | InChI=1S/C9H20N6/c1-5-15(4)6-12-8(10)14-9(11)13-7(2)3/h5-6H2,1-4H3,(H4,10,11,12,14) |
| InChIKey | LPSSHKRKWHNNPJ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[N'-[[ethyl(methyl)amino]methyl]carbamimidoyl]-3-propan-2-ylideneguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[N'-[[ethyl(methyl)amino]methyl]carbamimidoyl]-3-propan-2-ylideneguanidine?
The IUPAC name of 1-[N'-[[ethyl(methyl)amino]methyl]carbamimidoyl]-3-propan-2-ylideneguanidine (CID 176522076) is 1-[N'-[[ethyl(methyl)amino]methyl]carbamimidoyl]-3-propan-2-ylideneguanidine.
What is the SMILES notation for 1-[N'-[[ethyl(methyl)amino]methyl]carbamimidoyl]-3-propan-2-ylideneguanidine?
The canonical SMILES for 1-[N'-[[ethyl(methyl)amino]methyl]carbamimidoyl]-3-propan-2-ylideneguanidine is [H]/N=C(\N=C(C)C)NC(N)=NCN(C)CC.
What is the InChIKey of 1-[N'-[[ethyl(methyl)amino]methyl]carbamimidoyl]-3-propan-2-ylideneguanidine?
The InChIKey is LPSSHKRKWHNNPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N6/c1-5-15(4)6-12-8(10)14-9(11)13-7(2)3/h5-6H2,1-4H3,(H4,10,11,12,14).
What are the key properties of 1-[N'-[[ethyl(methyl)amino]methyl]carbamimidoyl]-3-propan-2-ylideneguanidine?
1-[N'-[[ethyl(methyl)amino]methyl]carbamimidoyl]-3-propan-2-ylideneguanidine has a molecular weight of 212.30 g/mol, XLogP of 0.22, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[N'-[[ethyl(methyl)amino]methyl]carbamimidoyl]-3-propan-2-ylideneguanidine is sourced from PubChem (CID 176522076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).