C7H15AlKN4 — CID 135991968
CID 135991968 (PubChem CID 135991968) has the molecular formula C7H15AlKN4 and a molecular weight of 221.30 g/mol.
| Compound Name | CID 135991968 |
|---|---|
| PubChem CID | 135991968 |
| Molecular Formula | C7H15AlKN4 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | — |
| SMILES | [H]/N=C(C[Al])/N=C(\N)CN(C)CC.[K] |
| InChI | InChI=1S/C7H15N4.Al.K/c1-4-11(3)5-7(9)10-6(2)8;;/h2,4-5H2,1,3H3,(H3,8,9,10);; |
| InChIKey | TVZAMFFCGRHHJR-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 65.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|