C16H35N3O3Si — CID 163453659
N,N-bis[2-(propan-2-ylideneamino)ethyl]-3-trimethoxysilylpropan-1-amine (PubChem CID 163453659) has the molecular formula C16H35N3O3Si and a molecular weight of 345.56 g/mol. Its IUPAC name is N,N-bis[2-(propan-2-ylideneamino)ethyl]-3-trimethoxysilylpropan-1-amine.
| Compound Name | N,N-bis[2-(propan-2-ylideneamino)ethyl]-3-trimethoxysilylpropan-1-amine |
|---|---|
| PubChem CID | 163453659 |
| Molecular Formula | C16H35N3O3Si |
| Molecular Weight | 345.56 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | N,N-bis[2-(propan-2-ylideneamino)ethyl]-3-trimethoxysilylpropan-1-amine |
| SMILES | CO[Si](CCCN(CCN=C(C)C)CCN=C(C)C)(OC)OC |
| InChI | InChI=1S/C16H35N3O3Si/c1-15(2)17-9-12-19(13-10-18-16(3)4)11-8-14-23(20-5,21-6)22-7/h8-14H2,1-7H3 |
| InChIKey | HZRYSWXTFNLXKZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 55.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.56 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|