C19H39N3 — CID 167613512
N-methyl-3-(4-methylpentan-2-ylideneamino)-N-[3-(4-methylpentan-2-ylideneamino)propyl]propan-1-amine (PubChem CID 167613512) has the molecular formula C19H39N3 and a molecular weight of 309.54 g/mol. Its IUPAC name is N-methyl-3-(4-methylpentan-2-ylideneamino)-N-[3-(4-methylpentan-2-ylideneamino)propyl]propan-1-amine.
| Compound Name | N-methyl-3-(4-methylpentan-2-ylideneamino)-N-[3-(4-methylpentan-2-ylideneamino)propyl]propan-1-amine |
|---|---|
| PubChem CID | 167613512 |
| Molecular Formula | C19H39N3 |
| Molecular Weight | 309.54 g/mol |
| Exact Mass | 309.31 |
| IUPAC Name | N-methyl-3-(4-methylpentan-2-ylideneamino)-N-[3-(4-methylpentan-2-ylideneamino)propyl]propan-1-amine |
| SMILES | C/C(CC(C)C)=N\CCCN(C)CCC/N=C(\C)CC(C)C |
| InChI | InChI=1S/C19H39N3/c1-16(2)14-18(5)20-10-8-12-22(7)13-9-11-21-19(6)15-17(3)4/h16-17H,8-15H2,1-7H3/b20-18+,21-19+ |
| InChIKey | LKADEBWUBQWHHQ-FRCMOREXSA-N |
| XLogP | 4.71 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.54 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|