C16H25NOS — CID 176946252
4-methyl-N-(3-phenylmethoxysulfanylpropyl)pentan-2-imine (PubChem CID 176946252) has the molecular formula C16H25NOS and a molecular weight of 279.45 g/mol. Its IUPAC name is 4-methyl-N-(3-phenylmethoxysulfanylpropyl)pentan-2-imine.
| Compound Name | 4-methyl-N-(3-phenylmethoxysulfanylpropyl)pentan-2-imine |
|---|---|
| PubChem CID | 176946252 |
| Molecular Formula | C16H25NOS |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 4-methyl-N-(3-phenylmethoxysulfanylpropyl)pentan-2-imine |
| SMILES | C/C(CC(C)C)=N\CCCSOCc1ccccc1 |
| InChI | InChI=1S/C16H25NOS/c1-14(2)12-15(3)17-10-7-11-19-18-13-16-8-5-4-6-9-16/h4-6,8-9,14H,7,10-13H2,1-3H3/b17-15+ |
| InChIKey | HCPZFRYAPJILHT-BMRADRMJSA-N |
| XLogP | 4.75 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|