C11H23N3O — CID 178130175
3-[3-(dimethylamino)propylimino]-N,N-dimethylbutanamide (PubChem CID 178130175) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is 3-[3-(dimethylamino)propylimino]-N,N-dimethylbutanamide.
| Compound Name | 3-[3-(dimethylamino)propylimino]-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 178130175 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 3-[3-(dimethylamino)propylimino]-N,N-dimethylbutanamide |
| SMILES | C/C(CC(=O)N(C)C)=N\CCCN(C)C |
| InChI | InChI=1S/C11H23N3O/c1-10(9-11(15)14(4)5)12-7-6-8-13(2)3/h6-9H2,1-5H3/b12-10+ |
| InChIKey | QTGTWASEUHRUKT-ZRDIBKRKSA-N |
| XLogP | 0.88 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|