About 3-butyliminobutanoate
3-butyliminobutanoate (PubChem CID 23175602) has the molecular formula C8H14NO2-
and a molecular weight of 156.20 g/mol. Its IUPAC name is 3-butyliminobutanoate.
Molecular Properties
| Compound Name | 3-butyliminobutanoate |
| PubChem CID | 23175602 |
| Molecular Formula | C8H14NO2- |
| Molecular Weight | 156.20 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | 3-butyliminobutanoate |
| SMILES | CCCC/N=C(\C)CC(=O)[O-] |
| InChI | InChI=1S/C8H15NO2/c1-3-4-5-9-7(2)6-8(10)11/h3-6H2,1-2H3,(H,10,11)/p-1/b9-7+ |
| InChIKey | WVVKXZRMRQHDNL-VQHVLOKHSA-M |
| XLogP | 0.39 |
| TPSA | 52.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.20 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-butyliminobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyliminobutanoate?
The IUPAC name of 3-butyliminobutanoate (CID 23175602) is 3-butyliminobutanoate.
What is the SMILES notation for 3-butyliminobutanoate?
The canonical SMILES for 3-butyliminobutanoate is CCCC/N=C(\C)CC(=O)[O-].
What is the InChIKey of 3-butyliminobutanoate?
The InChIKey is WVVKXZRMRQHDNL-VQHVLOKHSA-M. The full InChI is InChI=1S/C8H15NO2/c1-3-4-5-9-7(2)6-8(10)11/h3-6H2,1-2H3,(H,10,11)/p-1/b9-7+.
What are the key properties of 3-butyliminobutanoate?
3-butyliminobutanoate has a molecular weight of 156.20 g/mol, XLogP of 0.39, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyliminobutanoate is sourced from PubChem (CID 23175602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).