C44H84N6O4 — CID 18715962
6-[3-[bis[2-(4-methylpentan-2-ylideneamino)ethyl]amino]propanoyloxy]hexyl 3-[bis[2-(4-methylpentan-2-ylideneamino)ethyl]amino]propanoate (PubChem CID 18715962) has the molecular formula C44H84N6O4 and a molecular weight of 761.19 g/mol. Its IUPAC name is 6-[3-[bis[2-(4-methylpentan-2-ylideneamino)ethyl]amino]propanoyloxy]hexyl 3-[bis[2-(4-methylpentan-2-ylideneamino)ethyl]amino]propanoate.
| Compound Name | 6-[3-[bis[2-(4-methylpentan-2-ylideneamino)ethyl]amino]propanoyloxy]hexyl 3-[bis[2-(4-methylpentan-2-ylideneamino)ethyl]amino]propanoate |
|---|---|
| PubChem CID | 18715962 |
| Molecular Formula | C44H84N6O4 |
| Molecular Weight | 761.19 g/mol |
| Exact Mass | 760.66 |
| IUPAC Name | 6-[3-[bis[2-(4-methylpentan-2-ylideneamino)ethyl]amino]propanoyloxy]hexyl 3-[bis[2-(4-methylpentan-2-ylideneamino)ethyl]amino]propanoate |
| SMILES | C/C(CC(C)C)=N\CCN(CC/N=C(\C)CC(C)C)CCC(=O)OCCCCCCOC(=O)CCN(CC/N=C(\C)CC(C)C)CC/N=C(\C)CC(C)C |
| InChI | InChI=1S/C44H84N6O4/c1-35(2)31-39(9)45-19-25-49(26-20-46-40(10)32-36(3)4)23-17-43(51)53-29-15-13-14-16-30-54-44(52)18-24-50(27-21-47-41(11)33-37(5)6)28-22-48-42(12)34-38(7)8/h35-38H,13-34H2,1-12H3/b45-39+,46-40+,47-41+,48-42+ |
| InChIKey | NXDHMMAYHOPTMQ-KWSNRDBBSA-N |
| XLogP | 9.05 |
| TPSA | 108.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.19 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|