About 5-azidopentyl 3-[bis[3-(5-azidopentoxy)-3-oxopropyl]amino]propanoate
5-azidopentyl 3-[bis[3-(5-azidopentoxy)-3-oxopropyl]amino]propanoate (PubChem CID 132604980) has the molecular formula C24H42N10O6
and a molecular weight of 566.66 g/mol. Its IUPAC name is 5-azidopentyl 3-[bis[3-(5-azidopentoxy)-3-oxopropyl]amino]propanoate.
Molecular Properties
| Compound Name | 5-azidopentyl 3-[bis[3-(5-azidopentoxy)-3-oxopropyl]amino]propanoate |
| PubChem CID | 132604980 |
| Molecular Formula | C24H42N10O6 |
| Molecular Weight | 566.66 g/mol |
| Exact Mass | 566.33 |
| IUPAC Name | 5-azidopentyl 3-[bis[3-(5-azidopentoxy)-3-oxopropyl]amino]propanoate |
| SMILES | [N-]=[N+]=NCCCCCOC(=O)CCN(CCC(=O)OCCCCCN=[N+]=[N-])CCC(=O)OCCCCCN=[N+]=[N-] |
| InChI | InChI=1S/C24H42N10O6/c25-31-28-13-4-1-7-19-38-22(35)10-16-34(17-11-23(36)39-20-8-2-5-14-29-32-26)18-12-24(37)40-21-9-3-6-15-30-33-27/h1-21H2 |
| InChIKey | KIJIDKFTIIFMMP-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 228.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 566.66 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 5-azidopentyl 3-[bis[3-(5-azidopentoxy)-3-oxopropyl]amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-azidopentyl 3-[bis[3-(5-azidopentoxy)-3-oxopropyl]amino]propanoate?
The IUPAC name of 5-azidopentyl 3-[bis[3-(5-azidopentoxy)-3-oxopropyl]amino]propanoate (CID 132604980) is 5-azidopentyl 3-[bis[3-(5-azidopentoxy)-3-oxopropyl]amino]propanoate.
What is the SMILES notation for 5-azidopentyl 3-[bis[3-(5-azidopentoxy)-3-oxopropyl]amino]propanoate?
The canonical SMILES for 5-azidopentyl 3-[bis[3-(5-azidopentoxy)-3-oxopropyl]amino]propanoate is [N-]=[N+]=NCCCCCOC(=O)CCN(CCC(=O)OCCCCCN=[N+]=[N-])CCC(=O)OCCCCCN=[N+]=[N-].
What is the InChIKey of 5-azidopentyl 3-[bis[3-(5-azidopentoxy)-3-oxopropyl]amino]propanoate?
The InChIKey is KIJIDKFTIIFMMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H42N10O6/c25-31-28-13-4-1-7-19-38-22(35)10-16-34(17-11-23(36)39-20-8-2-5-14-29-32-26)18-12-24(37)40-21-9-3-6-15-30-33-27/h1-21H2.
What are the key properties of 5-azidopentyl 3-[bis[3-(5-azidopentoxy)-3-oxopropyl]amino]propanoate?
5-azidopentyl 3-[bis[3-(5-azidopentoxy)-3-oxopropyl]amino]propanoate has a molecular weight of 566.66 g/mol, XLogP of 5.53, 27 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 5-azidopentyl 3-[bis[3-(5-azidopentoxy)-3-oxopropyl]amino]propanoate is sourced from PubChem (CID 132604980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).